Structure of PDB 4dwb Chain A Binding Site BS04 |
|
|
Ligand ID | 0M7 |
InChI | InChI=1S/C7H19NO6P2/c1-2-3-4-5-8-6-7(15(9,10)11)16(12,13)14/h7-8H,2-6H2,1H3,(H2,9,10,11)(H2,12,13,14) |
InChIKey | YDYMUJPNPOBLGS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCCCCNCC(P(=O)(O)O)P(=O)(O)O | ACDLabs 12.01 | O=P(O)(O)C(CNCCCCC)P(=O)(O)O | CACTVS 3.370 | CCCCCNCC([P](O)(O)=O)[P](O)(O)=O |
|
Formula | C7 H19 N O6 P2 |
Name | [2-(pentylamino)ethane-1,1-diyl]bis(phosphonic acid) |
ChEMBL | CHEMBL409012 |
DrugBank | |
ZINC | ZINC000029061035
|
PDB chain | 4dwb Chain A Residue 509
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|