Structure of PDB 4dgr Chain A Binding Site BS04 |
|
|
Ligand ID | 3LV |
InChI | InChI=1S/C20H30N2O5/c1-3-9-21(10-4-2)12-16-11-15(19(26)27)5-6-17(16)22-18(25)7-8-20(22,13-23)14-24/h5-6,11,23-24H,3-4,7-10,12-14H2,1-2H3,(H,26,27) |
InChIKey | IYODICUSAICAQL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CCCN(CCC)Cc1cc(ccc1N2C(=O)CCC2(CO)CO)C(=O)O | CACTVS 3.352 | CCCN(CCC)Cc1cc(ccc1N2C(=O)CCC2(CO)CO)C(O)=O |
|
Formula | C20 H30 N2 O5 |
Name | 4-[2,2-bis(hydroxymethyl)-5-oxopyrrolidin-1-yl]-3-[(dipropylamino)methyl]benzoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921229
|
PDB chain | 4dgr Chain A Residue 488
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|