Structure of PDB 3tem Chain A Binding Site BS04 |
|
|
Ligand ID | 6A1 |
InChI | InChI=1S/C19H24N4O3/c1-23(2,25)9-8-20-14-5-6-15-18-17(14)19(24)13-10-12(26-3)4-7-16(13)22(18)11-21-15/h4,7,10-11,14,20,25H,5-6,8-9H2,1-3H3/p+1/t14-/m0/s1 |
InChIKey | VTPADFJSUDVABF-AWEZNQCLSA-O |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1ccc2n3cnc4CC[CH](NCC[N+](C)(C)O)c(c(O)c2c1)c34 | OpenEye OEToolkits 1.7.2 | C[N+](C)(CCNC1CCc2c3c1c(c4cc(ccc4n3cn2)OC)O)O | CACTVS 3.370 | COc1ccc2n3cnc4CC[C@H](NCC[N+](C)(C)O)c(c(O)c2c1)c34 | ACDLabs 12.01 | n2c4c3c(c(O)c1cc(OC)ccc1n3c2)C(NCC[N+](O)(C)C)CC4 |
|
Formula | C19 H25 N4 O3 |
Name | hydroxy(2-{[(5S)-6-hydroxy-8-methoxy-4,5-dihydro-3H-imidazo[4,5,1-de]acridin-5-yl]amino}ethyl)dimethylammonium |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920599
|
PDB chain | 3tem Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
G149 Y155 N161 |
Catalytic site (residue number reindexed from 1) |
G148 Y154 N160 |
Enzyme Commision number |
1.10.5.1: ribosyldihydronicotinamide dehydrogenase (quinone). |
|
|
|