Structure of PDB 3qj5 Chain A Binding Site BS04 |
|
|
Ligand ID | 022 |
InChI | InChI=1S/C24H22N4O3/c1-16-14-18(24(25)31)4-9-21(16)28-20(8-11-23(29)30)7-10-22(28)17-2-5-19(6-3-17)27-13-12-26-15-27/h2-7,9-10,12-15H,8,11H2,1H3,(H2,25,31)(H,29,30) |
InChIKey | YVPGZQLRPAGKLA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)CCc4ccc(c2ccc(n1ccnc1)cc2)n4c3c(cc(C(=O)N)cc3)C | OpenEye OEToolkits 1.7.0 | Cc1cc(ccc1n2c(ccc2c3ccc(cc3)n4ccnc4)CCC(=O)O)C(=O)N | CACTVS 3.370 | Cc1cc(ccc1n2c(CCC(O)=O)ccc2c3ccc(cc3)n4ccnc4)C(N)=O |
|
Formula | C24 H22 N4 O3 |
Name | 3-{1-(4-carbamoyl-2-methylphenyl)-5-[4-(1H-imidazol-1-yl)phenyl]-1H-pyrrol-2-yl}propanoic acid; N6022 |
ChEMBL | CHEMBL1738699 |
DrugBank | DB12206 |
ZINC | ZINC000066156654
|
PDB chain | 3qj5 Chain A Residue 374
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|