Structure of PDB 1sr5 Chain A Binding Site BS04 |
|
|
Ligand ID | U9G |
InChI | InChI=1S/C8H16O9S/c1-14-6-5(9)4(3-16-18(11,12)13)17-8(10)7(6)15-2/h4-10H,3H2,1-2H3,(H,11,12,13)/t4-,5-,6+,7-,8+/m1/s1 |
InChIKey | SYRNRUURZIIPLL-CBQIKETKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CO[C@H]1[C@@H]([C@H](O[C@@H]([C@@H]1OC)O)COS(=O)(=O)O)O | CACTVS 3.385 | CO[CH]1[CH](O)O[CH](CO[S](O)(=O)=O)[CH](O)[CH]1OC | ACDLabs 12.01 | OC1C(OC(C(C1OC)OC)O)COS(O)(=O)=O | OpenEye OEToolkits 2.0.7 | COC1C(C(OC(C1OC)O)COS(=O)(=O)O)O | CACTVS 3.385 | CO[C@H]1[C@@H](O)O[C@H](CO[S](O)(=O)=O)[C@@H](O)[C@@H]1OC |
|
Formula | C8 H16 O9 S |
Name | 2,3-di-O-methyl-6-O-sulfo-alpha-D-glucopyranose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000006483310
|
PDB chain | 1sr5 Chain D Residue 5
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|