Structure of PDB 8sqw Chain K Binding Site BS03 |
|
|
Ligand ID | HXG |
InChI | InChI=1S/C20H40NO8P/c1-6-8-10-12-19(22)26-16-18(29-20(23)13-11-9-7-2)17-28-30(24,25)27-15-14-21(3,4)5/h18H,6-17H2,1-5H3/p+1/t18-/m1/s1 |
InChIKey | DVZARZBAWHITHR-GOSISDBHSA-O |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(OCC(OC(=O)CCCCC)COP(=O)(OCC[N+](C)(C)C)O)CCCCC | CACTVS 3.385 | CCCCCC(=O)OC[CH](CO[P](O)(=O)OCC[N+](C)(C)C)OC(=O)CCCCC | OpenEye OEToolkits 1.9.2 | CCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCC | OpenEye OEToolkits 1.9.2 | CCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCC | CACTVS 3.385 | CCCCCC(=O)OC[C@H](CO[P](O)(=O)OCC[N+](C)(C)C)OC(=O)CCCCC |
|
Formula | C20 H41 N O8 P |
Name | 1,2-dihexanoyl-sn-glycero-3-phosphocholine; (4R,7R)-7-(hexanoyloxy)-4-hydroxy-N,N,N-trimethyl-10-oxo-3,5,9-trioxa-4-phosphapentadecan-1-aminium 4-oxide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013543441
|
PDB chain | 8sqw Chain K Residue 307
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.14.13.25: methane monooxygenase (soluble). |
|
|
|