Structure of PDB 6zgp Chain K Binding Site BS03 |
|
|
Ligand ID | QKQ |
InChI | InChI=1S/C22H21N5O2/c1-29-18-6-3-16(4-7-18)19-14-24-13-17-5-8-20(26-21(17)19)22(28)25-9-2-11-27-12-10-23-15-27/h3-8,10,12-15H,2,9,11H2,1H3,(H,25,28) |
InChIKey | HZXZTAAZILWOMG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(cc1)c2cncc3ccc(nc23)C(=O)NCCCn4ccnc4 | OpenEye OEToolkits 2.0.7 | COc1ccc(cc1)c2cncc3c2nc(cc3)C(=O)NCCCn4ccnc4 |
|
Formula | C22 H21 N5 O2 |
Name | ~{N}-(3-imidazol-1-ylpropyl)-8-(4-methoxyphenyl)-1,6-naphthyridine-2-carboxamide |
ChEMBL | CHEMBL525112 |
DrugBank | |
ZINC | ZINC000001739875
|
PDB chain | 6zgp Chain K Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|