Structure of PDB 6zuu Chain H Binding Site BS03 |
|
|
Ligand ID | QQN |
InChI | InChI=1S/C22H24ClN3O4/c1-13-12-26(7-6-17(13)27)21(28)15-9-18(29-2)20-19(10-15)30-22(25-20)24-11-14-4-3-5-16(23)8-14/h3-5,8-10,13,17,27H,6-7,11-12H2,1-2H3,(H,24,25)/t13-,17-/m1/s1 |
InChIKey | KWIHKRFBOTYCIM-CXAGYDPISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(cc2oc(NCc3cccc(Cl)c3)nc12)C(=O)N4CC[CH](O)[CH](C)C4 | CACTVS 3.385 | COc1cc(cc2oc(NCc3cccc(Cl)c3)nc12)C(=O)N4CC[C@@H](O)[C@H](C)C4 | OpenEye OEToolkits 2.0.7 | CC1CN(CCC1O)C(=O)c2cc3c(c(c2)OC)nc(o3)NCc4cccc(c4)Cl | OpenEye OEToolkits 2.0.7 | C[C@@H]1CN(CC[C@H]1O)C(=O)c2cc3c(c(c2)OC)nc(o3)NCc4cccc(c4)Cl |
|
Formula | C22 H24 Cl N3 O4 |
Name | [2-[(3-chlorophenyl)methylamino]-4-methoxy-1,3-benzoxazol-6-yl]-[(3~{R},4~{R})-3-methyl-4-oxidanyl-piperidin-1-yl]methanone |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6zuu Chain H Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|