Structure of PDB 6t53 Chain H Binding Site BS03 |
|
|
Ligand ID | K73 |
InChI | InChI=1S/C22H28N4O2/c23-14-17-8-10-18(11-9-17)15-25-21(27)20-7-4-12-26(20)22(28)19(24)13-16-5-2-1-3-6-16/h1-3,5-6,8-11,19-20H,4,7,12-15,23-24H2,(H,25,27)/t19-,20+/m1/s1 |
InChIKey | MTUGEKUGFKKRIV-UXHICEINSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NCc1ccc(CNC(=O)[CH]2CCCN2C(=O)[CH](N)Cc3ccccc3)cc1 | CACTVS 3.385 | NCc1ccc(CNC(=O)[C@@H]2CCCN2C(=O)[C@H](N)Cc3ccccc3)cc1 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)C[C@H](C(=O)N2CCC[C@H]2C(=O)NCc3ccc(cc3)CN)N | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)CC(C(=O)N2CCCC2C(=O)NCc3ccc(cc3)CN)N |
|
Formula | C22 H28 N4 O2 |
Name | (2~{S})-~{N}-[[4-(aminomethyl)phenyl]methyl]-1-[(2~{R})-2-azanyl-3-phenyl-propanoyl]pyrrolidine-2-carboxamide |
ChEMBL | CHEMBL4761989 |
DrugBank | |
ZINC |
|
PDB chain | 6t53 Chain H Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|