Structure of PDB 3egk Chain H Binding Site BS03 |
|
|
Ligand ID | M18 |
InChI | InChI=1S/C20H27ClN2O5/c1-20(2,3)28-19(26)22-12-17(24)23-9-5-8-16(23)13-27-18(25)11-14-6-4-7-15(21)10-14/h4,6-7,10,16H,5,8-9,11-13H2,1-3H3,(H,22,26)/t16-/m0/s1 |
InChIKey | ONXGIEJBNQLITK-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CC(C)(C)OC(=O)NCC(=O)N1CCC[C@H]1COC(=O)Cc2cccc(Cl)c2 | ACDLabs 10.04 | O=C(N1CCCC1COC(=O)Cc2cccc(Cl)c2)CNC(=O)OC(C)(C)C | OpenEye OEToolkits 1.5.0 | CC(C)(C)OC(=O)NCC(=O)N1CCC[C@H]1COC(=O)Cc2cccc(c2)Cl | CACTVS 3.341 | CC(C)(C)OC(=O)NCC(=O)N1CCC[CH]1COC(=O)Cc2cccc(Cl)c2 | OpenEye OEToolkits 1.5.0 | CC(C)(C)OC(=O)NCC(=O)N1CCCC1COC(=O)Cc2cccc(c2)Cl |
|
Formula | C20 H27 Cl N2 O5 |
Name | {(2S)-1-[N-(tert-butoxycarbonyl)glycyl]pyrrolidin-2-yl}methyl (3-chlorophenyl)acetate; (3-Chloro-Phenyl)-acetic acid (S)-1-(2-tert-butoxycarbonylamino-acetyl)-pyrrolidin-2-ylmethyl ester |
ChEMBL | |
DrugBank | DB08152 |
ZINC | ZINC000039188026
|
PDB chain | 3egk Chain H Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.5: thrombin. |
|
|
|