Structure of PDB 3dt0 Chain H Binding Site BS03 |
|
|
Ligand ID | 16U |
InChI | InChI=1S/C18H25ClN2O2/c1-13(2)8-9-17(22)21-10-4-7-16(21)18(23)20-12-14-5-3-6-15(19)11-14/h3,5-6,11,13,16H,4,7-10,12H2,1-2H3,(H,20,23)/t16-/m0/s1 |
InChIKey | PQUULPKGCNPPBX-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(NCc1cccc(Cl)c1)C2N(C(=O)CCC(C)C)CCC2 | CACTVS 3.370 | CC(C)CCC(=O)N1CCC[CH]1C(=O)NCc2cccc(Cl)c2 | OpenEye OEToolkits 1.7.0 | CC(C)CCC(=O)N1CCCC1C(=O)NCc2cccc(c2)Cl | CACTVS 3.370 | CC(C)CCC(=O)N1CCC[C@H]1C(=O)NCc2cccc(Cl)c2 | OpenEye OEToolkits 1.7.0 | CC(C)CCC(=O)N1CCC[C@H]1C(=O)NCc2cccc(c2)Cl |
|
Formula | C18 H25 Cl N2 O2 |
Name | N-(3-chlorobenzyl)-1-(4-methylpentanoyl)-L-prolinamide |
ChEMBL | CHEMBL1229677 |
DrugBank | DB06868 |
ZINC | ZINC000039137935
|
PDB chain | 3dt0 Chain H Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.5: thrombin. |
|
|
|