Structure of PDB 3dhk Chain H Binding Site BS03 |
|
|
Ligand ID | 23U |
InChI | InChI=1S/C27H28ClN3O2/c28-22-14-7-9-19(17-22)18-30-26(32)23-15-8-16-31(23)27(33)25(29)24(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-7,9-14,17,23-25H,8,15-16,18,29H2,(H,30,32)/t23-,25+/m0/s1 |
InChIKey | LJTKFVOSAVCILF-UKILVPOCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1ccc(cc1)C(c2ccccc2)C(C(=O)N3CCCC3C(=O)NCc4cccc(c4)Cl)N | CACTVS 3.341 | N[CH](C(c1ccccc1)c2ccccc2)C(=O)N3CCC[CH]3C(=O)NCc4cccc(Cl)c4 | ACDLabs 10.04 | O=C(NCc1cccc(Cl)c1)C4N(C(=O)C(N)C(c2ccccc2)c3ccccc3)CCC4 | CACTVS 3.341 | N[C@H](C(c1ccccc1)c2ccccc2)C(=O)N3CCC[C@H]3C(=O)NCc4cccc(Cl)c4 | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)C(c2ccccc2)[C@H](C(=O)N3CCC[C@H]3C(=O)NCc4cccc(c4)Cl)N |
|
Formula | C27 H28 Cl N3 O2 |
Name | beta-phenyl-D-phenylalanyl-N-(3-chlorobenzyl)-L-prolinamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013779051
|
PDB chain | 3dhk Chain H Residue 1601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.5: thrombin. |
|
|
|