Structure of PDB 2ziq Chain H Binding Site BS03 |
|
|
Ligand ID | 26U |
InChI | InChI=1S/C19H28N4O2/c1-13(2)5-10-17(24)23-11-3-4-16(23)19(25)22-12-14-6-8-15(9-7-14)18(20)21/h6-9,13,16H,3-5,10-12H2,1-2H3,(H3,20,21)(H,22,25)/t16-/m0/s1 |
InChIKey | AEKJCSNKYXWOAQ-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.5 | [H]/N=C(/c1ccc(cc1)CNC(=O)[C@@H]2CCCN2C(=O)CCC(C)C)\N | CACTVS 3.385 | CC(C)CCC(=O)N1CCC[CH]1C(=O)NCc2ccc(cc2)C(N)=N | OpenEye OEToolkits 1.7.5 | CC(C)CCC(=O)N1CCCC1C(=O)NCc2ccc(cc2)C(=N)N | ACDLabs 10.04 | O=C(NCc1ccc(C(=[N@H])N)cc1)C2N(C(=O)CCC(C)C)CCC2 | CACTVS 3.385 | CC(C)CCC(=O)N1CCC[C@H]1C(=O)NCc2ccc(cc2)C(N)=N |
|
Formula | C19 H28 N4 O2 |
Name | N-(4-carbamimidoylbenzyl)-1-(4-methylpentanoyl)-L-prolinamide |
ChEMBL | CHEMBL1229851 |
DrugBank | DB06936 |
ZINC | ZINC000039029983
|
PDB chain | 2ziq Chain H Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.5: thrombin. |
|
|
|