Structure of PDB 2zgx Chain H Binding Site BS03 |
|
|
Ligand ID | 29U |
InChI | InChI=1S/C17H25N5O2/c1-2-13(18)17(24)22-9-3-4-14(22)16(23)21-10-11-5-7-12(8-6-11)15(19)20/h5-8,13-14H,2-4,9-10,18H2,1H3,(H3,19,20)(H,21,23)/t13-,14+/m1/s1 |
InChIKey | YHAMQFKGUUSJMU-KGLIPLIRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC[C@@H](N)C(=O)N1CCC[C@H]1C(=O)NCc2ccc(cc2)C(N)=N | OpenEye OEToolkits 1.7.5 | CCC(C(=O)N1CCCC1C(=O)NCc2ccc(cc2)C(=N)N)N | ACDLabs 10.04 | O=C(NCc1ccc(C(=[N@H])N)cc1)C2N(C(=O)C(N)CC)CCC2 | CACTVS 3.385 | CC[CH](N)C(=O)N1CCC[CH]1C(=O)NCc2ccc(cc2)C(N)=N | OpenEye OEToolkits 1.7.5 | [H]/N=C(/c1ccc(cc1)CNC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC)N)\N |
|
Formula | C17 H25 N5 O2 |
Name | 1-[(2R)-2-aminobutanoyl]-N-(4-carbamimidoylbenzyl)-L-prolinamide |
ChEMBL | CHEMBL1198148 |
DrugBank | DB06947 |
ZINC | ZINC000039024957
|
PDB chain | 2zgx Chain H Residue 1601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.5: thrombin. |
|
|
|