Structure of PDB 2zg0 Chain H Binding Site BS03 |
|
|
Ligand ID | 50U |
InChI | InChI=1S/C22H32N4O2/c23-21(24)18-11-8-17(9-12-18)15-25-22(28)19-7-4-14-26(19)20(27)13-10-16-5-2-1-3-6-16/h8-9,11-12,16,19H,1-7,10,13-15H2,(H3,23,24)(H,25,28)/t19-/m0/s1 |
InChIKey | DOTBZTLJSXFKCP-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC(=N)c1ccc(CNC(=O)[CH]2CCCN2C(=O)CCC3CCCCC3)cc1 | OpenEye OEToolkits 1.7.5 | [H]/N=C(/c1ccc(cc1)CNC(=O)[C@@H]2CCCN2C(=O)CCC3CCCCC3)\N | CACTVS 3.385 | NC(=N)c1ccc(CNC(=O)[C@@H]2CCCN2C(=O)CCC3CCCCC3)cc1 | OpenEye OEToolkits 1.7.5 | c1cc(ccc1CNC(=O)C2CCCN2C(=O)CCC3CCCCC3)C(=N)N | ACDLabs 12.01 | O=C(NCc1ccc(C(=[N@H])N)cc1)C3N(C(=O)CCC2CCCCC2)CCC3 |
|
Formula | C22 H32 N4 O2 |
Name | (S)-N-(4-carbamimidoylbenzyl)-1-(3-cyclohexylpropanoyl)pyrrolidine-2-carboxamide |
ChEMBL | CHEMBL1198138 |
DrugBank | DB07131 |
ZINC | ZINC000039018741
|
PDB chain | 2zg0 Chain H Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.5: thrombin. |
|
|
|