Structure of PDB 6b2f Chain G Binding Site BS03 |
|
|
Ligand ID | HLN |
InChI | InChI=1S/C16H21O3P/c1-2-3-4-7-12-20(17,18)19-16-11-10-14-8-5-6-9-15(14)13-16/h5-6,8-11,13H,2-4,7,12H2,1H3,(H,17,18) |
InChIKey | UBECMGZHZQOIIW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCCCCCP(=O)(O)Oc1ccc2ccccc2c1 | CACTVS 3.370 | CCCCCC[P](O)(=O)Oc1ccc2ccccc2c1 | ACDLabs 12.01 | O=P(O)(Oc2ccc1c(cccc1)c2)CCCCCC |
|
Formula | C16 H21 O3 P |
Name | hexyl(naphthalen-2-yloxy)phosphinic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208994
|
PDB chain | 6b2f Chain G Residue 2404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|