Structure of PDB 6v7f Chain E Binding Site BS03 |
|
|
Ligand ID | QRJ |
InChI | InChI=1S/C12H24BN2O5/c14-12(10(16)17)7-11(3-5-15-8-11)6-9(12)2-1-4-13(18,19)20/h9,15,18-20H,1-8,14H2,(H,16,17)/q-1/p+2/t9-,11-,12-/m0/s1 |
InChIKey | IOCRPFIKFQALKS-DLOVCJGASA-P |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | OC(C2(CC1(C[NH2+]CC1)CC2CCC[B-](O)(O)O)[NH3+])=O | CACTVS 3.385 | [NH3+][C]1(C[C]2(CC[NH2+]C2)C[CH]1CCC[B-](O)(O)O)C(O)=O | CACTVS 3.385 | [NH3+][C@]1(C[C@]2(CC[NH2+]C2)C[C@@H]1CCC[B-](O)(O)O)C(O)=O | OpenEye OEToolkits 2.0.7 | [B-](CCCC1CC2(CC[NH2+]C2)CC1(C(=O)O)[NH3+])(O)(O)O | OpenEye OEToolkits 2.0.7 | [B-](CCC[C@H]1C[C@@]2(CC[NH2+]C2)C[C@]1(C(=O)O)[NH3+])(O)(O)O |
|
Formula | C12 H26 B N2 O5 |
Name | {3-[(5R,7S,8S)-8-azaniumyl-8-carboxy-2-azaspiro[4.4]nonan-2-ium-7-yl]propyl}(trihydroxy)borate(1-) |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6v7f Chain E Residue 1003
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|