Structure of PDB 4z83 Chain E Binding Site BS03 |
|
|
Ligand ID | 4L7 |
InChI | InChI=1S/C17H14BrN3O2S/c18-15-4-3-14(24-15)16(22)12-7-19-6-11(12)9-1-2-10-13(5-9)20-8-21-17(10)23/h1-5,8,11-12,19H,6-7H2,(H,20,21,23)/t11-,12+/m1/s1 |
InChIKey | ZYTJGVHIDBAIRI-NEPJUHHUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Brc1sc(cc1)C(=O)[C@H]2CNC[C@@H]2c3ccc4C(=O)NC=Nc4c3 | OpenEye OEToolkits 1.9.2 | c1cc2c(cc1C3CNCC3C(=O)c4ccc(s4)Br)N=CNC2=O | CACTVS 3.385 | Brc1sc(cc1)C(=O)[CH]2CNC[CH]2c3ccc4C(=O)NC=Nc4c3 | ACDLabs 12.01 | C(=O)(C1C(CNC1)c3cc2N=CNC(=O)c2cc3)c4ccc(Br)s4 | OpenEye OEToolkits 1.9.2 | c1cc2c(cc1[C@H]3CNC[C@@H]3C(=O)c4ccc(s4)Br)N=CNC2=O |
|
Formula | C17 H14 Br N3 O2 S |
Name | 7-{(3S,4R)-4-[(5-bromothiophen-2-yl)carbonyl]pyrrolidin-3-yl}quinazolin-4(3H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263621371
|
PDB chain | 4z83 Chain E Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
N171 D184 |
Catalytic site (residue number reindexed from 1) |
N158 D171 |
Enzyme Commision number |
2.7.11.11: cAMP-dependent protein kinase. |
|
|
|