Structure of PDB 4ntk Chain E Binding Site BS03 |
|
|
Ligand ID | ZSP |
InChI | InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h15-16H,2H2,1H3,(H4,10,11,13,14,17)/b6-3- |
InChIKey | FYDGMRRMOMSOLR-UTCJRWHESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C/C(=C(\C1=NC2=C(NC1)N=C(NC2=O)N)/O)/O | CACTVS 3.385 | CC(O)=C(O)C1=NC2=C(NC1)N=C(N)NC2=O | CACTVS 3.385 | CC(/O)=C(O)\C1=NC2=C(NC1)N=C(N)NC2=O | OpenEye OEToolkits 1.7.6 | CC(=C(C1=NC2=C(NC1)N=C(NC2=O)N)O)O | ACDLabs 12.01 | O=C1C=2N=C(C(\O)=C(\O)C)CNC=2N=C(N)N1 |
|
Formula | C9 H11 N5 O3 |
Name | 2-amino-6-[(1Z)-1,2-dihydroxyprop-1-en-1-yl]-7,8-dihydropteridin-4(3H)-one; Sepiapterin (enol-form) |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103562712
|
PDB chain | 4ntk Chain E Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H31 H33 E110 |
Catalytic site (residue number reindexed from 1) |
H30 H32 E109 |
Enzyme Commision number |
4.1.2.50: 6-carboxytetrahydropterin synthase. |
|
|
|