Structure of PDB 8ihs Chain D Binding Site BS03 |
|
|
Ligand ID | 97U |
InChI | InChI=1S/C20H18ClNO6/c1-10-7-12-14(21)9-13(17(23)16(12)20(27)28-10)18(24)22-15(19(25)26)8-11-5-3-2-4-6-11/h2-6,9-10,15,23H,7-8H2,1H3,(H,22,24)(H,25,26)/t10-,15+/m1/s1 |
InChIKey | RWQKHEORZBHNRI-BMIGLBTASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC1Cc2c(cc(c(c2C(=O)O1)O)C(=O)NC(Cc3ccccc3)C(=O)O)Cl | CACTVS 3.385 | C[C@@H]1Cc2c(Cl)cc(c(O)c2C(=O)O1)C(=O)N[C@@H](Cc3ccccc3)C(O)=O | CACTVS 3.385 | C[CH]1Cc2c(Cl)cc(c(O)c2C(=O)O1)C(=O)N[CH](Cc3ccccc3)C(O)=O | OpenEye OEToolkits 2.0.7 | C[C@@H]1Cc2c(cc(c(c2C(=O)O1)O)C(=O)N[C@@H](Cc3ccccc3)C(=O)O)Cl |
|
Formula | C20 H18 Cl N O6 |
Name | (2~{S})-2-[[(3~{R})-5-chloranyl-3-methyl-8-oxidanyl-1-oxidanylidene-3,4-dihydroisochromen-7-yl]carbonylamino]-3-phenyl-propanoic acid |
ChEMBL | CHEMBL589366 |
DrugBank | |
ZINC | ZINC000003861782
|
PDB chain | 8ihs Chain D Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|