Structure of PDB 7jxm Chain D Binding Site BS03 |
|
|
Ligand ID | 9LL |
InChI | InChI=1S/C19H14FN3O3S/c20-12-5-6-15(24)14(9-12)16(17(25)22-19-21-7-8-27-19)23-10-11-3-1-2-4-13(11)18(23)26/h1-9,16,24H,10H2,(H,21,22,25)/t16-/m1/s1 |
InChIKey | YTUFHOKUFOQRDF-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Oc1ccc(F)cc1[C@@H](N2Cc3ccccc3C2=O)C(=O)Nc4sccn4 | OpenEye OEToolkits 2.0.6 | c1ccc2c(c1)CN(C2=O)C(c3cc(ccc3O)F)C(=O)Nc4nccs4 | OpenEye OEToolkits 2.0.6 | c1ccc2c(c1)CN(C2=O)[C@H](c3cc(ccc3O)F)C(=O)Nc4nccs4 | ACDLabs 12.01 | C(=O)(C(c1c(ccc(c1)F)O)N3Cc2c(cccc2)C3=O)Nc4nccs4 | CACTVS 3.385 | Oc1ccc(F)cc1[CH](N2Cc3ccccc3C2=O)C(=O)Nc4sccn4 |
|
Formula | C19 H14 F N3 O3 S |
Name | (2R)-2-(5-fluoro-2-hydroxyphenyl)-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide |
ChEMBL | CHEMBL4452106 |
DrugBank | |
ZINC | ZINC000575624026
|
PDB chain | 7jxm Chain D Residue 1103
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.10.1: receptor protein-tyrosine kinase. |
|
|
|