Structure of PDB 7cvn Chain D Binding Site BS03 |
|
|
Ligand ID | FBP |
InChI | InChI=1S/C6H14O12P2/c7-4-3(1-16-19(10,11)12)18-6(9,5(4)8)2-17-20(13,14)15/h3-5,7-9H,1-2H2,(H2,10,11,12)(H2,13,14,15)/t3-,4-,5+,6-/m1/s1 |
InChIKey | RNBGYGVWRKECFJ-ARQDHWQXSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | O[C@H]1[C@H](O)[C@@](O)(CO[P](O)(O)=O)O[C@@H]1CO[P](O)(O)=O | CACTVS 3.341 | O[CH]1[CH](O)[C](O)(CO[P](O)(O)=O)O[CH]1CO[P](O)(O)=O | ACDLabs 10.04 | O=P(O)(O)OCC1OC(O)(COP(=O)(O)O)C(O)C1O | OpenEye OEToolkits 1.5.0 | C(C1C(C(C(O1)(COP(=O)(O)O)O)O)O)OP(=O)(O)O | OpenEye OEToolkits 1.5.0 | C([C@@H]1[C@H]([C@@H]([C@](O1)(COP(=O)(O)O)O)O)O)OP(=O)(O)O |
|
Formula | C6 H14 O12 P2 |
Name | 1,6-di-O-phosphono-beta-D-fructofuranose; BETA-FRUCTOSE-1,6-DIPHOSPHATE; FRUCTOSE-1,6-BISPHOSPHATE; 1,6-di-O-phosphono-beta-D-fructose; 1,6-di-O-phosphono-D-fructose; 1,6-di-O-phosphono-fructose |
ChEMBL | CHEMBL97893 |
DrugBank | DB04551 |
ZINC | ZINC000004096694
|
PDB chain | 7cvn Chain D Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|