Structure of PDB 6y6d Chain D Binding Site BS03 |
|
|
Ligand ID | OBQ |
InChI | InChI=1S/C21H22N2O6/c1-23-7-6-10-8-13-19(28-9-27-13)20(26-3)14(10)17(23)18-11-4-5-12(25-2)16(22)15(11)21(24)29-18/h4-5,8,17-18H,6-7,9,22H2,1-3H3/t17-,18+/m1/s1 |
InChIKey | WPUKOXIOPURGHT-MSOLQXFVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc2[CH](OC(=O)c2c1N)[CH]3N(C)CCc4cc5OCOc5c(OC)c34 | OpenEye OEToolkits 2.0.7 | CN1CCc2cc3c(c(c2[C@@H]1[C@@H]4c5ccc(c(c5C(=O)O4)N)OC)OC)OCO3 | CACTVS 3.385 | COc1ccc2[C@H](OC(=O)c2c1N)[C@@H]3N(C)CCc4cc5OCOc5c(OC)c34 | OpenEye OEToolkits 2.0.7 | CN1CCc2cc3c(c(c2C1C4c5ccc(c(c5C(=O)O4)N)OC)OC)OCO3 |
|
Formula | C21 H22 N2 O6 |
Name | (3~{S})-7-azanyl-6-methoxy-3-[(5~{R})-4-methoxy-6-methyl-7,8-dihydro-5~{H}-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-3~{H}-2-benzofuran-1-one |
ChEMBL | CHEMBL376130 |
DrugBank | |
ZINC | ZINC000013675153
|
PDB chain | 6y6d Chain D Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|