Structure of PDB 6h4q Chain D Binding Site BS03 |
|
|
Ligand ID | FO2 |
InChI | InChI=1S/C16H18N6O/c1-21-6-3-11(4-7-21)12-8-20-22(9-12)15-14-13(2-5-17-15)16(23)19-10-18-14/h2,5,8-11H,3-4,6-7H2,1H3,(H,18,19,23) |
InChIKey | WDLBUONJQGHSKT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CN1CCC(CC1)c2cnn(c2)c3c4c(ccn3)C(=O)NC=N4 | CACTVS 3.385 | CN1CCC(CC1)c2cnn(c2)c3nccc4C(=O)NC=Nc34 |
|
Formula | C16 H18 N6 O |
Name | 8-[4-(1-methylpiperidin-4-yl)pyrazol-1-yl]-3~{H}-pyrido[3,4-d]pyrimidin-4-one |
ChEMBL | CHEMBL4483780 |
DrugBank | |
ZINC |
|
PDB chain | 6h4q Chain D Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 6h4q C8-substituted pyrido[3,4-d]pyrimidin-4(3H)-ones: Studies towards the identification of potent, cell penetrant Jumonji C domain containing histone lysine demethylase 4 subfamily (KDM4) inhibitors, compound profiling in cell-based target engagement assays. |
Resolution | 2.31 Å |
Binding residue (original residue number in PDB) | Y132 G170 Y177 F185 H188 E190 D191 K206 W208 K241 H276 |
Binding residue (residue number reindexed from 1) | Y124 G162 Y169 F177 H180 E182 D183 K198 W200 K233 H268 |
Annotation score | 1 |
Binding affinity | MOAD: ic50=2.06uM BindingDB: IC50=2060nM |
|
|
|
|