Structure of PDB 6fs6 Chain D Binding Site BS03 |
|
|
Ligand ID | E4Z |
InChI | InChI=1S/C24H19F2N3O4S/c25-16-6-5-13-15(20(16)26)12-34-18-4-2-1-3-14(18)21(13)29-19-11-33-10-9-27(19)24(32)22-23(31)17(30)7-8-28(22)29/h1-8,19,21,31H,9-12H2/t19-,21+/m1/s1 |
InChIKey | FIDLLEYNNRGVFR-CTNGQTDRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc2c(c1)C(c3ccc(c(c3CS2)F)F)N4C5COCCN5C(=O)C6=C(C(=O)C=CN64)O | CACTVS 3.385 | OC1=C2N(C=CC1=O)N([C@@H]3COCCN3C2=O)[C@H]4c5ccc(F)c(F)c5CSc6ccccc46 | OpenEye OEToolkits 2.0.6 | c1ccc2c(c1)[C@H](c3ccc(c(c3CS2)F)F)N4[C@@H]5COCCN5C(=O)C6=C(C(=O)C=CN64)O | CACTVS 3.385 | OC1=C2N(C=CC1=O)N([CH]3COCCN3C2=O)[CH]4c5ccc(F)c(F)c5CSc6ccccc46 |
|
Formula | C24 H19 F2 N3 O4 S |
Name | Baloxavir acid |
ChEMBL | CHEMBL4297215 |
DrugBank | DB15675 |
ZINC |
|
PDB chain | 6fs6 Chain D Residue 903
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|