Structure of PDB 5f3i Chain D Binding Site BS03 |
|
|
Ligand ID | 5UJ |
InChI | InChI=1S/C23H22Cl2N6O/c24-18-9-17(10-19(25)11-18)16-3-7-30(8-4-16)6-2-15-12-29-31(13-15)22-21-20(1-5-26-22)23(32)28-14-27-21/h1,5,9-14,16H,2-4,6-8H2,(H,27,28,32) |
InChIKey | RLRGPZGIQMEBLC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Clc1cc(Cl)cc(c1)C2CCN(CC2)CCc3cnn(c3)c4nccc5C(=O)NC=Nc45 | OpenEye OEToolkits 2.0.4 | c1cnc(c2c1C(=O)NC=N2)n3cc(cn3)CCN4CCC(CC4)c5cc(cc(c5)Cl)Cl |
|
Formula | C23 H22 Cl2 N6 O |
Name | 8-[4-[2-[4-[3,5-bis(chloranyl)phenyl]piperidin-1-yl]ethyl]pyrazol-1-yl]-3~{H}-pyrido[3,4-d]pyrimidin-4-one |
ChEMBL | CHEMBL3775894 |
DrugBank | |
ZINC | ZINC000263620975
|
PDB chain | 5f3i Chain D Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|