Structure of PDB 4q3a Chain D Binding Site BS03 |
|
|
Ligand ID | 2YC |
InChI | InChI=1S/C12H21N3O3/c1-8-5-7-14-10(8)11(16)15-6-3-2-4-9(13)12(17)18/h7-10H,2-6,13H2,1H3,(H,15,16)(H,17,18)/t8-,9-,10-/m0/s1 |
InChIKey | ZFOMKMMPBOQKMC-GUBZILKMSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(NCCCCC(C(=O)O)N)C1N=CCC1C | OpenEye OEToolkits 1.7.6 | C[C@H]1CC=N[C@@H]1C(=O)NCCCC[C@@H](C(=O)O)N | OpenEye OEToolkits 1.7.6 | CC1CC=NC1C(=O)NCCCCC(C(=O)O)N | CACTVS 3.385 | C[CH]1CC=N[CH]1C(=O)NCCCC[CH](N)C(O)=O | CACTVS 3.385 | C[C@H]1CC=N[C@@H]1C(=O)NCCCC[C@H](N)C(O)=O |
|
Formula | C12 H21 N3 O3 |
Name | N~6~-{[(2S,3S)-3-methyl-3,4-dihydro-2H-pyrrol-2-yl]carbonyl}-L-lysine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000050875538
|
PDB chain | 4q3a Chain D Residue 904
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|