Structure of PDB 3fwp Chain D Binding Site BS03 |
|
|
Ligand ID | ANU |
InChI | InChI=1S/C9H10N2O5/c12-3-4-6(14)7-8(15-4)11-2-1-5(13)10-9(11)16-7/h1-2,4,6-8,12,14H,3H2/t4-,6-,7+,8-/m1/s1 |
InChIKey | UUGITDASWNOAGG-CCXZUQQUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C1=CN2[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)OC2=NC1=O | CACTVS 3.385 | OC[C@H]1O[C@@H]2[C@@H](OC3=NC(=O)C=CN23)[C@@H]1O | OpenEye OEToolkits 2.0.6 | C1=CN2C3C(C(C(O3)CO)O)OC2=NC1=O | CACTVS 3.385 | OC[CH]1O[CH]2[CH](OC3=NC(=O)C=CN23)[CH]1O |
|
Formula | C9 H10 N2 O5 |
Name | 2,2'-Anhydro-(1-beta-D-arabinofuranosyl)uracil; Anhydrouridine; 2,2'-ANHYDROURIDINE; CYCLOURIDINE |
ChEMBL | CHEMBL3251336 |
DrugBank | DB04627 |
ZINC | ZINC000000315929
|
PDB chain | 3fwp Chain D Residue 7013
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|