Structure of PDB 2vvp Chain D Binding Site BS03 |
|
|
Ligand ID | R52 |
InChI | InChI=1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h1,3-5,7-9H,2H2,(H2,10,11,12)/t3-,4+,5-/m0/s1 |
InChIKey | PPQRONHOSHZGFQ-LMVFSUKVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C([C@H]([C@H]([C@H](C=O)O)O)O)OP(=O)(O)O | ACDLabs 10.04 | O=P(O)(O)OCC(O)C(O)C(O)C=O | CACTVS 3.341 | O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@@H](O)C=O | CACTVS 3.341 | O[CH](CO[P](O)(O)=O)[CH](O)[CH](O)C=O | OpenEye OEToolkits 1.5.0 | C(C(C(C(C=O)O)O)O)OP(=O)(O)O |
|
Formula | C5 H11 O8 P |
Name | 5-O-phosphono-D-ribose |
ChEMBL | |
DrugBank | DB02053 |
ZINC | ZINC000022116391
|
PDB chain | 2vvp Chain D Residue 200
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|