Structure of PDB 2al4 Chain D Binding Site BS03 |
|
|
Ligand ID | CX6 |
InChI | InChI=1S/C13H13NO4/c15-13-8-6-10-11(17-5-4-16-10)7-9(8)18-12-2-1-3-14(12)13/h6-7,12H,1-5H2/t12-/m1/s1 |
InChIKey | RQEPVMAYUINZRE-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1c2c(cc3c1OCCO3)OC4CCCN4C2=O | ACDLabs 10.04 | O=C1c3c(OC2N1CCC2)cc4OCCOc4c3 | OpenEye OEToolkits 1.5.0 | c1c2c(cc3c1OCCO3)O[C@@H]4CCCN4C2=O | CACTVS 3.341 | O=C1N2CCC[CH]2Oc3cc4OCCOc4cc13 | CACTVS 3.341 | O=C1N2CCC[C@H]2Oc3cc4OCCOc4cc13 |
|
Formula | C13 H13 N O4 |
Name | 2,3,6A,7,8,9-HEXAHYDRO-11H-[1,4]DIOXINO[2,3-G]PYRROLO[2,1-B][1,3]BENZOXAZIN-11-ONE |
ChEMBL | |
DrugBank | DB07598 |
ZINC | ZINC000003959449
|
PDB chain | 2al4 Chain F Residue 803
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|