Structure of PDB 1h5r Chain D Binding Site BS03 |
|
|
Ligand ID | G1P |
InChI | InChI=1S/C6H13O9P/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5-,6-/m1/s1 |
InChIKey | HXXFSFRBOHSIMQ-VFUOTHLCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC[CH]1O[CH](O[P](O)(O)=O)[CH](O)[CH](O)[CH]1O | ACDLabs 12.01 | O=P(O)(OC1OC(C(O)C(O)C1O)CO)O | OpenEye OEToolkits 1.7.0 | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OP(=O)(O)O)O)O)O)O | CACTVS 3.370 | OC[C@H]1O[C@H](O[P](O)(O)=O)[C@H](O)[C@@H](O)[C@@H]1O | OpenEye OEToolkits 1.7.0 | C(C1C(C(C(C(O1)OP(=O)(O)O)O)O)O)O |
|
Formula | C6 H13 O9 P |
Name | 1-O-phosphono-alpha-D-glucopyranose; ALPHA-D-GLUCOSE-1-PHOSPHATE; 1-O-phosphono-alpha-D-glucose; 1-O-phosphono-D-glucose; 1-O-phosphono-glucose |
ChEMBL | |
DrugBank | DB02843 |
ZINC | ZINC000004073375
|
PDB chain | 1h5r Chain D Residue 1294
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.7.24: glucose-1-phosphate thymidylyltransferase. |
|
|
|