Structure of PDB 8ptt Chain C Binding Site BS03 |
|
|
Ligand ID | F2V |
InChI | InChI=1S/C20H20ClF3N6/c1-28-12-27-17-16(28)18(26-11-25-17)30-7-5-19(10-30)4-6-29(9-19)13-2-3-14(15(21)8-13)20(22,23)24/h2-3,8,11-12H,4-7,9-10H2,1H3/t19-/m1/s1 |
InChIKey | CAPZLSKZPWSIKV-LJQANCHMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cn1cnc2c1c(ncn2)N3CCC4(C3)CCN(C4)c5ccc(c(c5)Cl)C(F)(F)F | CACTVS 3.385 | Cn1cnc2ncnc(N3CC[C@@]4(CCN(C4)c5ccc(c(Cl)c5)C(F)(F)F)C3)c12 | CACTVS 3.385 | Cn1cnc2ncnc(N3CC[C]4(CCN(C4)c5ccc(c(Cl)c5)C(F)(F)F)C3)c12 | OpenEye OEToolkits 2.0.7 | Cn1cnc2c1c(ncn2)N3CC[C@]4(C3)CCN(C4)c5ccc(c(c5)Cl)C(F)(F)F |
|
Formula | C20 H20 Cl F3 N6 |
Name | 6-[(5~{R})-7-[3-chloranyl-4-(trifluoromethyl)phenyl]-2,7-diazaspiro[4.4]nonan-2-yl]-7-methyl-purine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8ptt Chain D Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|