Structure of PDB 8cap Chain C Binding Site BS03 |
|
|
Ligand ID | U4O |
InChI | InChI=1S/C29H26N4O3/c34-28(25-12-3-4-13-30-25)32-14-16-33(17-15-32)29(35)26-22-9-1-2-11-24(22)31-27-20(7-5-10-23(26)27)19-21-8-6-18-36-21/h1-4,6,8-9,11-13,18-19H,5,7,10,14-17H2/b20-19+ |
InChIKey | PINFHQOHENYZDE-FMQUCBEESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)c(c3c(n2)C(=Cc4ccco4)CCC3)C(=O)N5CCN(CC5)C(=O)c6ccccn6 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)c(c3c(n2)/C(=C/c4ccco4)/CCC3)C(=O)N5CCN(CC5)C(=O)c6ccccn6 | CACTVS 3.385 | O=C(N1CCN(CC1)C(=O)c2c3CCCC(=Cc4occc4)c3nc5ccccc25)c6ccccn6 | CACTVS 3.385 | O=C(N1CCN(CC1)C(=O)c2c3CCC\C(=C/c4occc4)c3nc5ccccc25)c6ccccn6 |
|
Formula | C29 H26 N4 O3 |
Name | [4-[[(4~{E})-4-(furan-2-ylmethylidene)-2,3-dihydro-1~{H}-acridin-9-yl]carbonyl]piperazin-1-yl]-pyridin-2-yl-methanone |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8cap Chain C Residue 802
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|