Structure of PDB 7uvb Chain C Binding Site BS03 |
|
|
Ligand ID | OHF |
InChI | InChI=1S/C20H22N2O6/c23-9-6-17-15(3-2-7-21-17)20(26)22-8-10-27-12-14(22)13-28-19-5-1-4-18(25)16(19)11-24/h1-5,7,11,14,23,25H,6,8-10,12-13H2/t14-/m0/s1 |
InChIKey | NIWBSQAKKNNWBT-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc(c(c(c1)OCC2COCCN2C(=O)c3cccnc3CCO)C=O)O | ACDLabs 12.01 | O=C(N1CCOCC1COc1cccc(O)c1C=O)c1cccnc1CCO | OpenEye OEToolkits 2.0.7 | c1cc(c(c(c1)OC[C@@H]2COCCN2C(=O)c3cccnc3CCO)C=O)O | CACTVS 3.385 | OCCc1ncccc1C(=O)N2CCOC[CH]2COc3cccc(O)c3C=O | CACTVS 3.385 | OCCc1ncccc1C(=O)N2CCOC[C@H]2COc3cccc(O)c3C=O |
|
Formula | C20 H22 N2 O6 |
Name | 2-hydroxy-6-({(3S)-4-[2-(2-hydroxyethyl)pyridine-3-carbonyl]morpholin-3-yl}methoxy)benzaldehyde |
ChEMBL | CHEMBL5314424 |
DrugBank | DB18071 |
ZINC |
|
PDB chain | 7uvb Chain C Residue 203
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|