Structure of PDB 6hx8 Chain C Binding Site BS03 |
|
|
Ligand ID | GXN |
InChI | InChI=1S/C19H23BrN2O6S/c1-25-16-9-14-11-22(5-4-13(14)8-17(16)28-29(21,23)24)10-12-6-15(20)19(27-3)18(7-12)26-2/h6-9H,4-5,10-11H2,1-3H3,(H2,21,23,24) |
InChIKey | AAQOREQGNICBFR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | COc1cc(cc(c1OC)Br)CN2CCc3cc(c(cc3C2)OC)OS(=O)(=O)N | CACTVS 3.385 | COc1cc2CN(CCc2cc1O[S](N)(=O)=O)Cc3cc(Br)c(OC)c(OC)c3 |
|
Formula | C19 H23 Br N2 O6 S |
Name | [2-[(3-bromanyl-4,5-dimethoxy-phenyl)methyl]-7-methoxy-3,4-dihydro-1~{H}-isoquinolin-6-yl] sulfamate |
ChEMBL | CHEMBL3622051 |
DrugBank | |
ZINC | ZINC000473133947
|
PDB chain | 6hx8 Chain D Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|