Structure of PDB 4zvz Chain C Binding Site BS03 |
|
|
Ligand ID | 4TF |
InChI | InChI=1S/C12H18O6/c1-2-3-17-5-6-4-7-8(11(13)14)9(12(15)16)10(6)18-7/h6-10H,2-5H2,1H3,(H,13,14)(H,15,16)/t6-,7+,8+,9+,10-/m0/s1 |
InChIKey | KENGHAXMPKBHLS-CHHOWFRJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CCCOCC1CC2C(C(C1O2)C(=O)O)C(=O)O | ACDLabs 12.01 | O=C(C1C(C(=O)O)C2OC1CC2COCCC)O | CACTVS 3.385 | CCCOC[CH]1C[CH]2O[CH]1[CH]([CH]2C(O)=O)C(O)=O | CACTVS 3.385 | CCCOC[C@@H]1C[C@H]2O[C@@H]1[C@@H]([C@@H]2C(O)=O)C(O)=O | OpenEye OEToolkits 1.9.2 | CCCOC[C@@H]1C[C@@H]2[C@H]([C@H]([C@H]1O2)C(=O)O)C(=O)O |
|
Formula | C12 H18 O6 |
Name | (1R,2S,3R,4S,5S)-5-(propoxymethyl)-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904934
|
PDB chain | 4zvz Chain C Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|