Structure of PDB 4u3f Chain C Binding Site BS03 |
|
|
Ligand ID | Y52 |
InChI | InChI=1S/C20H19NO4S2/c1-23-11-16(19(22)25-3)15-7-5-4-6-13(15)12-26-20-21-17-10-14(24-2)8-9-18(17)27-20/h4-11H,12H2,1-3H3/b16-11+ |
InChIKey | OMGAIUZPUSZZME-LFIBNONCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | COC=C(c1ccccc1CSc2nc3cc(ccc3s2)OC)C(=O)OC | OpenEye OEToolkits 1.9.2 | CO/C=C(\c1ccccc1CSc2nc3cc(ccc3s2)OC)/C(=O)OC | CACTVS 3.385 | COC=C(C(=O)OC)c1ccccc1CSc2sc3ccc(OC)cc3n2 | ACDLabs 12.01 | O=C(OC)\C(=C\OC)c1ccccc1CSc2nc3cc(OC)ccc3s2 | CACTVS 3.385 | CO/C=C(/C(=O)OC)c1ccccc1CSc2sc3ccc(OC)cc3n2 |
|
Formula | C20 H19 N O4 S2 |
Name | methyl (2E)-3-methoxy-2-(2-{[(5-methoxy-1,3-benzothiazol-2-yl)sulfanyl]methyl}phenyl)prop-2-enoate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000116142445
|
PDB chain | 4u3f Chain C Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|