Structure of PDB 4ie3 Chain C Binding Site BS03 |
|
|
Ligand ID | 1EE |
InChI | InChI=1S/C13H28BN2O6/c15-13(12(18)19,5-1-2-7-14(20,21)22)6-10-16-8-3-11(17)4-9-16/h11,17,20-22H,1-10,15H2,(H,18,19)/q-1/t13-/m1/s1 |
InChIKey | BEHPULZVRPBIEQ-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N[C@](CCCC[B-](O)(O)O)(CCN1CC[C@@H](O)CC1)C(O)=O | CACTVS 3.370 | N[C](CCCC[B-](O)(O)O)(CCN1CC[CH](O)CC1)C(O)=O | OpenEye OEToolkits 1.7.6 | [B-](CCCC[C@@](CCN1CCC(CC1)O)(C(=O)O)N)(O)(O)O | ACDLabs 12.01 | O=C(O)C(N)(CCN1CCC(O)CC1)CCCC[B-](O)(O)O | OpenEye OEToolkits 1.7.6 | [B-](CCCCC(CCN1CCC(CC1)O)(C(=O)O)N)(O)(O)O |
|
Formula | C13 H28 B N2 O6 |
Name | [(5R)-5-amino-5-carboxy-7-(4-hydroxypiperidin-1-yl)heptyl](trihydroxy)borate(1-) |
ChEMBL | |
DrugBank | |
ZINC | ZINC000206367558
|
PDB chain | 4ie3 Chain C Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|