Structure of PDB 3l70 Chain C Binding Site BS03 |
|
|
Ligand ID | JZV |
InChI | InChI=1S/C20H19F3N2O4/c1-13(14-8-6-9-16(11-14)20(21,22)23)24-29-12-15-7-4-5-10-17(15)18(25-28-3)19(26)27-2/h4-11H,12H2,1-3H3/b24-13-,25-18+ |
InChIKey | ONCZDRURRATYFI-KEEMFBDKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CON=C(C(=O)OC)c1ccccc1CON=C(C)c2cccc(c2)C(F)(F)F | OpenEye OEToolkits 1.7.0 | C/C(=N/OCc1ccccc1/C(=N\OC)/C(=O)OC)/c2cccc(c2)C(F)(F)F | OpenEye OEToolkits 1.7.0 | CC(=NOCc1ccccc1C(=NOC)C(=O)OC)c2cccc(c2)C(F)(F)F | CACTVS 3.352 | CO\N=C(C(=O)OC)/c1ccccc1CO\N=C(C)/c2cccc(c2)C(F)(F)F |
|
Formula | C20 H19 F3 N2 O4 |
Name | methyl (2E)-(methoxyimino)(2-{[({(1Z)-1-[3-(trifluoromethyl)phenyl]ethylidene}amino)oxy]methyl}phenyl)ethanoate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3l70 Chain C Residue 2001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|