Structure of PDB 2vcg Chain C Binding Site BS03 |
|
|
Ligand ID | S17 |
InChI | InChI=1S/C18H25BrN2O5/c1-26-18(24)15(12-13-8-10-14(19)11-9-13)20-16(22)6-4-2-3-5-7-17(23)21-25/h8-11,15,25H,2-7,12H2,1H3,(H,20,22)(H,21,23)/t15-/m0/s1 |
InChIKey | UPYGSQPRAHMDPD-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | COC(=O)C(Cc1ccc(cc1)Br)NC(=O)CCCCCCC(=O)NO | CACTVS 3.341 | COC(=O)[CH](Cc1ccc(Br)cc1)NC(=O)CCCCCCC(=O)NO | ACDLabs 10.04 | Brc1ccc(cc1)CC(C(=O)OC)NC(=O)CCCCCCC(=O)NO | OpenEye OEToolkits 1.5.0 | COC(=O)[C@H](Cc1ccc(cc1)Br)NC(=O)CCCCCCC(=O)NO | CACTVS 3.341 | COC(=O)[C@H](Cc1ccc(Br)cc1)NC(=O)CCCCCCC(=O)NO |
|
Formula | C18 H25 Br N2 O5 |
Name | methyl 4-bromo-N-[8-(hydroxyamino)-8-oxooctanoyl]-L-phenylalaninate |
ChEMBL | CHEMBL406734 |
DrugBank | DB08505 |
ZINC | ZINC000016052595
|
PDB chain | 2vcg Chain C Residue 1380
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|