Structure of PDB 8brn Chain B Binding Site BS03 |
|
|
Ligand ID | R9X |
InChI | InChI=1S/C21H30NO4P/c1-2-3-4-5-6-7-8-16-20(23)22-21(27(24,25)26)19-15-11-13-17-12-9-10-14-18(17)19/h9-15,21H,2-8,16H2,1H3,(H,22,23)(H2,24,25,26)/t21-/m1/s1 |
InChIKey | QQNUSDSQHYRTKZ-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCCCCCCC(=O)N[C@@H](c1cccc2ccccc12)[P](O)(O)=O | OpenEye OEToolkits 2.0.7 | CCCCCCCCCC(=O)N[C@@H](c1cccc2c1cccc2)P(=O)(O)O | OpenEye OEToolkits 2.0.7 | CCCCCCCCCC(=O)NC(c1cccc2c1cccc2)P(=O)(O)O | CACTVS 3.385 | CCCCCCCCCC(=O)N[CH](c1cccc2ccccc12)[P](O)(O)=O |
|
Formula | C21 H30 N O4 P |
Name | [(R)-(decanoylamino)-naphthalen-1-yl-methyl]phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000071341888
|
PDB chain | 8brn Chain B Residue 531
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.3.2: acid phosphatase. |
|
|
|