Structure of PDB 7oyx Chain B Binding Site BS03 |
|
|
Ligand ID | 3IK |
InChI | InChI=1S/C15H33NO5/c1-12(16)8-19-14(3)10-21-15(4)11-20-13(2)9-18-7-6-17-5/h12-15H,6-11,16H2,1-5H3/t12-,13+,14-,15+/m1/s1 |
InChIKey | JXGRSFWTZMOYKY-BARDWOONSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(COC(C)COC(C)COC(C)COCCOC)N | OpenEye OEToolkits 2.0.7 | C[C@H](CO[C@H](C)CO[C@@H](C)CO[C@@H](C)COCCOC)N | CACTVS 3.385 | COCCOC[C@H](C)OC[C@H](C)OC[C@@H](C)OC[C@@H](C)N | CACTVS 3.385 | COCCOC[CH](C)OC[CH](C)OC[CH](C)OC[CH](C)N |
|
Formula | C15 H33 N O5 |
Name | (2~{R})-1-[(2~{R})-1-[(2~{S})-1-[(2~{S})-1-(2-methoxyethoxy)propan-2-yl]oxypropan-2-yl]oxypropan-2-yl]oxypropan-2-amine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7oyx Chain B Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|