Structure of PDB 7kl0 Chain B Binding Site BS03 |
|
|
Ligand ID | UZD |
InChI | InChI=1S/C15H29NO7/c1-3-4-5-6-7-8-16-15(20)22-9-10-11(17)12(18)13(19)14(21-2)23-10/h10-14,17-19H,3-9H2,1-2H3,(H,16,20)/t10-,11-,12-,13+,14-/m0/s1 |
InChIKey | XPIVOYOQXKNYHA-YHQUGGNUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCCCCNC(=O)OC[C@@H]1O[C@H](OC)[C@H](O)[C@@H](O)[C@H]1O | CACTVS 3.385 | CCCCCCCNC(=O)OC[CH]1O[CH](OC)[CH](O)[CH](O)[CH]1O | ACDLabs 12.01 | O=C(OCC1OC(C(C(C1O)O)O)OC)NCCCCCCC | OpenEye OEToolkits 2.0.7 | CCCCCCCNC(=O)OC[C@H]1[C@@H]([C@@H]([C@H]([C@H](O1)OC)O)O)O | OpenEye OEToolkits 2.0.7 | CCCCCCCNC(=O)OCC1C(C(C(C(O1)OC)O)O)O |
|
Formula | C15 H29 N O7 |
Name | methyl 6-O-(heptylcarbamoyl)-beta-L-altropyranoside |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7kl0 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|