Structure of PDB 6zyn Chain B Binding Site BS03 |
|
|
Ligand ID | QT2 |
InChI | InChI=1S/C10H17NO4S2/c1-4-15-8(14)10(5-16)11-6(7(12)13)9(2,3)17-10/h6,11,16H,4-5H2,1-3H3,(H,12,13)/t6-,10-/m1/s1 |
InChIKey | PUOMKKVEJFJZFE-LHLIQPBNSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCOC(=O)[C@@]1(N[C@@H](C(S1)(C)C)C(=O)O)CS | OpenEye OEToolkits 2.0.7 | CCOC(=O)C1(NC(C(S1)(C)C)C(=O)O)CS | CACTVS 3.385 | CCOC(=O)[C]1(CS)N[CH](C(O)=O)C(C)(C)S1 | CACTVS 3.385 | CCOC(=O)[C@]1(CS)N[C@H](C(O)=O)C(C)(C)S1 |
|
Formula | C10 H17 N O4 S2 |
Name | (2~{S},4~{R})-2-ethoxycarbonyl-5,5-dimethyl-2-(sulfanylmethyl)-1,3-thiazolidine-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6zyn Chain B Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|