Structure of PDB 6wkb Chain B Binding Site BS03 |
|
|
Ligand ID | U4P |
InChI | InChI=1S/C9H12N2O5/c1-4-6(13)7(14)8(16-4)11-3-2-5(12)10-9(11)15/h2-4,6-8,13-14H,1H3,(H,10,12,15)/t4-,6-,7-,8-/m1/s1 |
InChIKey | WUBAOANSQGKRHF-XVFCMESISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC1C(C(C(O1)N2C=CC(=O)NC2=O)O)O | CACTVS 3.385 | C[C@H]1O[C@H]([C@H](O)[C@@H]1O)N2C=CC(=O)NC2=O | CACTVS 3.385 | C[CH]1O[CH]([CH](O)[CH]1O)N2C=CC(=O)NC2=O | ACDLabs 12.01 | O=C1NC(=O)C=CN1C2C(C(C(O2)C)O)O | OpenEye OEToolkits 2.0.7 | C[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=CC(=O)NC2=O)O)O |
|
Formula | C9 H12 N2 O5 |
Name | 5'-deoxyuridine |
ChEMBL | CHEMBL3250647 |
DrugBank | |
ZINC | ZINC000006490943
|
PDB chain | 6wkb Chain B Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.5.1.6: methionine adenosyltransferase. |
|
|
|