Structure of PDB 6r0q Chain B Binding Site BS03 |
|
|
Ligand ID | JNW |
InChI | InChI=1S/C13H12N2O5/c16-10-6-5-9(12(18)15-10)14-11(17)7-3-1-2-4-8(7)13(19)20/h1-4,9H,5-6H2,(H,14,17)(H,19,20)(H,15,16,18)/t9-/m0/s1 |
InChIKey | QTUSGYNZYGYXIN-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)c1ccccc1C(=O)N[C@H]2CCC(=O)NC2=O | OpenEye OEToolkits 2.0.7 | c1ccc(c(c1)C(=O)N[C@H]2CCC(=O)NC2=O)C(=O)O | CACTVS 3.385 | OC(=O)c1ccccc1C(=O)N[CH]2CCC(=O)NC2=O | OpenEye OEToolkits 2.0.7 | c1ccc(c(c1)C(=O)NC2CCC(=O)NC2=O)C(=O)O |
|
Formula | C13 H12 N2 O5 |
Name | 2-[[(3~{S})-2,6-bis(oxidanylidene)piperidin-3-yl]carbamoyl]benzoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6r0q Chain B Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|