Structure of PDB 6g3o Chain B Binding Site BS03 |
|
|
Ligand ID | EL8 |
InChI | InChI=1S/C18H20F3N3O5/c1-10(4-2-3-5-13(25)24-28)22-14-15(17(27)16(14)26)23-11-6-8-12(9-7-11)29-18(19,20)21/h6-10,22-23,28H,2-5H2,1H3,(H,24,25)/t10-/m1/s1 |
InChIKey | WFKNHSZTAURQLQ-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](CCCCC(=O)NO)NC1=C(Nc2ccc(OC(F)(F)F)cc2)C(=O)C1=O | OpenEye OEToolkits 2.0.6 | C[C@H](CCCCC(=O)NO)NC1=C(C(=O)C1=O)Nc2ccc(cc2)OC(F)(F)F | OpenEye OEToolkits 2.0.6 | CC(CCCCC(=O)NO)NC1=C(C(=O)C1=O)Nc2ccc(cc2)OC(F)(F)F | CACTVS 3.385 | C[C@H](CCCCC(=O)NO)NC1=C(Nc2ccc(OC(F)(F)F)cc2)C(=O)C1=O |
|
Formula | C18 H20 F3 N3 O5 |
Name | (6~{R})-6-[[3,4-bis(oxidanylidene)-2-[[4-(trifluoromethyloxy)phenyl]amino]cyclobuten-1-yl]amino]-~{N}-oxidanyl-heptanamide |
ChEMBL | CHEMBL4242292 |
DrugBank | |
ZINC |
|
PDB chain | 6g3o Chain B Residue 1004
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|