Structure of PDB 5y6e Chain B Binding Site BS03 |
|
|
Ligand ID | 8PO |
InChI | InChI=1S/C12H15NO4S/c1-7(6-18)11(15)13-10(12(16)17)8-2-4-9(14)5-3-8/h2-5,7,10,14,18H,6H2,1H3,(H,13,15)(H,16,17)/t7-,10-/m1/s1 |
InChIKey | XFVAHOYBWXJSDW-GMSGAONNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](CS)C(=O)N[CH](C(O)=O)c1ccc(O)cc1 | OpenEye OEToolkits 2.0.6 | CC(CS)C(=O)NC(c1ccc(cc1)O)C(=O)O | OpenEye OEToolkits 2.0.6 | C[C@H](CS)C(=O)N[C@H](c1ccc(cc1)O)C(=O)O | CACTVS 3.385 | C[C@H](CS)C(=O)N[C@@H](C(O)=O)c1ccc(O)cc1 |
|
Formula | C12 H15 N O4 S |
Name | (2R)-2-(4-hydroxyphenyl)-2-[[(2S)-2-methyl-3-sulfanyl-propanoyl]amino]ethanoic acid; (R)-2-(4-hydroxyphenyl)-2-((S)-3-mercapto-2-methylpropanamido)acetic acid |
ChEMBL | CHEMBL4167648 |
DrugBank | |
ZINC |
|
PDB chain | 5y6e Chain B Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|