Structure of PDB 5o7n Chain B Binding Site BS03 |
|
|
Ligand ID | 9NK |
InChI | InChI=1S/C16H21NO3S/c18-15(17-9-5-4-8-14(17)16(19)20)13(11-21)10-12-6-2-1-3-7-12/h1-3,6-7,13-14,21H,4-5,8-11H2,(H,19,20)/t13-,14-/m1/s1 |
InChIKey | BUVJKPXAJVVXFT-ZIAGYGMSSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(cc1)CC(CS)C(=O)N2CCCCC2C(=O)O | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)C[C@H](CS)C(=O)N2CCCC[C@@H]2C(=O)O | CACTVS 3.385 | OC(=O)[C@H]1CCCCN1C(=O)[C@@H](CS)Cc2ccccc2 | CACTVS 3.385 | OC(=O)[CH]1CCCCN1C(=O)[CH](CS)Cc2ccccc2 |
|
Formula | C16 H21 N O3 S |
Name | (2~{R})-1-[(2~{S})-2-(phenylmethyl)-3-sulfanyl-propanoyl]piperidine-2-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5o7n Chain B Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|