Structure of PDB 5nhz Chain B Binding Site BS03 |
|
|
Ligand ID | 8XZ |
InChI | InChI=1S/C13H19O4PS/c1-11(14)19-10-13(18(15,16)17)9-5-8-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-10H2,1H3,(H2,15,16,17)/t13-/m1/s1 |
InChIKey | YKOSPDLKXQRIKT-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(=O)SCC(CCCc1ccccc1)P(=O)(O)O | CACTVS 3.385 | CC(=O)SC[C@@H](CCCc1ccccc1)[P](O)(O)=O | OpenEye OEToolkits 2.0.6 | CC(=O)SC[C@@H](CCCc1ccccc1)P(=O)(O)O | CACTVS 3.385 | CC(=O)SC[CH](CCCc1ccccc1)[P](O)(O)=O |
|
Formula | C13 H19 O4 P S |
Name | [(2~{R})-1-ethanoylsulfanyl-5-phenyl-pentan-2-yl]phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5nhz Chain B Residue 407
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|